BindingDB logo
myBDB logout

5 SMILES Strings for Adenosine A2b receptor

Compound NameSMILES String
BDBM50086170 CCCn1c2nc([nH]c2c(=O)n(CCC)c1=O)-c1ccc(OCC(=O)Nc2ccc(cc2)C#N)cc1
BDBM50116458 Cn1c(nc2NC(=O)N3CCN=C3c12)-c1ccccc1 |c:11|
BDBM50211685 N(c1cccnc1)c1ncc(-c2ccncn2)c(n1)-c1ccco1
BDBM50268232 CCCn1c(=O)[nH]c2nc([nH]c2c1=O)-c1ccc(cc1)S(=O)(=O)N1CCN(CC1)c1ccc(Cl)cc1
BDBM50336977 Fc1cnccc1-c1ncc(NC(=O)C2CC2)nc1-c1cccnc1