BindingDB logo
myBDB logout

10 SMILES Strings for Adenosine Phosphosulfate Reductase (APSR)

Compound NameSMILES String
BDBM22858 [O-][N+](=O)c1ccc-2c(c1)C(=O)C(=O)c1ccccc-21
BDBM25465 [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC=C1[C@@]3(C)CC[C@H](O)C[C@]33C=C[C@]21C(C3C(O)=O)C(O)=O |c:23,t:12,THB:15:13:24.25:22.21,11:12:24.25:22.21,14:13:24.25:22.21|
BDBM25466 CC(=O)Nc1cc2C(=O)c3ccccc3-c2cc1[N+]([O-])=O
BDBM25467 [O-][N+](=O)c1cc2C(=O)c3ccccc3-c2c(c1)[N+]([O-])=O
BDBM25468 [O-][N+](=O)c1cc2C(=O)c3cc(F)ccc3-c2cc1F
BDBM25469 [O-][N+](=O)c1ccc(Sc2cccc[n+]2[O-])c2nonc12
BDBM25460 OC(=O)CS(=O)c1ccc2-c3ccccc3C(=O)c3cccc1c23
BDBM25462 [O-][N+](=O)c1cc2C(=O)c3ccccc3-c2cc1[N+]([O-])=O
BDBM25463 OC(=O)CSc1nnc2c3ccccc3c3ccccc3c2n1
BDBM25464 Nc1nc(Sc2ccc([N+]([O-])=O)c3nonc23)c2[nH]cnc2n1