BindingDB logo
myBDB logout

1 SMILES String for Adenosine deaminase 3 (SanADA3)

Compound NameSMILES String
BDBM223291 OC[C@H]1O[C@H](C[C@@H]1O)n1cnc2[C@H](O)CN=CNc12 |c:16|