BindingDB logo
myBDB logout

4 SMILES Strings for Adenosine transporter

Compound NameSMILES String
BDBM82071 COc1ccc(cc1)C(CN(C)C)C1(O)CCCCC1
BDBM84745 CNCC[C@H](Oc1cccc2ccccc12)c1cccs1 |r|
BDBM86748 CN(C)CC(c1ccc(O)cc1)C1(O)CCCCC1
BDBM50022784 CNCCC(Oc1ccccc1C)c1ccccc1