BindingDB logo
myBDB logout

4 SMILES Strings for Adenosinetriphosphatase

Compound NameSMILES String
BDBM50064182 CO\C(=C/C=C/c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)NC1CC(C)(C)NC(C)(C)C1
BDBM50064186 CO[C@H]1\C=C\C=C(C)\C[C@H](C)[C@H](O)[C@H](C)\C=C(/C)\C=C(OC)\C(=O)O[C@@H]1[C@@H](C)[C@@H](O)[C@H](C)[C@@]1(O)C[C@@H](O)[C@H](C)[C@H](O1)C(C)C |c:5,15,18,t:3|
BDBM50086849 CC1(C)CC(CC(C)(C)N1)NC(=O)c1cccc(CC(=O)Nc2ccc(Cl)c(Cl)c2)c1
BDBM50086850 CC1(C)CC(CC(C)(C)N1)NC(=O)\C=C\C=C\C(=O)Nc1ccc(Cl)c(Cl)c1