BindingDB logo
myBDB logout

5 SMILES Strings for Adenosylhomocysteinase 2

Compound NameSMILES String
BDBM50140074 Nc1ncc(Br)c2n(cnc12)[C@@H]1C=C(CO)[C@@H](O)[C@H]1O |r,t:14|
BDBM50140078 Nc1ncc(Br)c2n(cnc12)C1=C[C@@H](CO)[C@H](O)[C@@H]1O |r,t:13|
BDBM50140075 Nc1nccc2n(cnc12)C1=C[C@H](CO)[C@@H](O)[C@H]1O |r,t:12|
BDBM50140076 Nc1nccc2n(cnc12)C1=C[C@@H](CO)[C@H](O)[C@@H]1O |r,t:12|
BDBM50140077 Nc1ncc(Br)c2n(cnc12)C1=C[C@H](CO)[C@@H](O)[C@H]1O |r,t:13|