BindingDB logo
myBDB logout

4 SMILES Strings for Adenylate cyclase Forskolin

Compound NameSMILES String
BDBM82071 COc1ccc(cc1)C(CN(C)C)C1(O)CCCCC1
BDBM84745 CNCC[C@H](Oc1cccc2ccccc12)c1cccs1 |r|
BDBM50010685 Oc1cc2CC[C@H]3NCc4ccccc4[C@H]3c2cc1O
BDBM50022784 CNCCC(Oc1ccccc1C)c1ccccc1