BindingDB logo
myBDB logout

4 SMILES Strings for Adenylate cyclase type 10

Compound NameSMILES String
BDBM50158383 C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]1CC[C@@H]2C(=O)COS(=O)(=O)c1ccc(Br)cc1 |r,t:8|
BDBM50198305 OC(=O)c1cc2C3C(C4C(c2cc1S(O)(=O)=O)C1(Cl)C(Cl)=C(Cl)C4(Cl)C1(Cl)Cl)C1(Cl)C(Cl)=C(Cl)C3(Cl)C1(Cl)Cl |t:22,35|
BDBM50262140 C[C@]12CC[C@H]3[C@@H](CCc4cc(O)c(O)cc34)[C@@H]1CC[C@@H]2O |r|
BDBM50262191 C[C@H]1O[C@H](C[C@@H]1OP([O-])(=O)OP([O-])(=O)OP(O)([O-])=O)n1cnc2c(N)ncnc12 |r|