BindingDB logo
myBDB logout

20 SMILES Strings for Adenylate cyclase type V

Compound NameSMILES String
BDBM14487 Nc1ncnc2n(cnc12)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O
BDBM50008363 Nc1nc(F)nc2n(cnc12)C1CC(O)C(CO)O1
BDBM50009854 O=C(c1cn(CCN2CCOCC2)c2ccccc12)c1cccc2ccccc12
BDBM50009864 Cc1c(C(=O)c2cccc3ccccc23)c2ccccc2n1CCN1CCOCC1
BDBM50010684 CCCN1Cc2ccccc2[C@H]2[C@H]1CCc1cc(O)c(O)cc21
BDBM50010686 Oc1cc2CC[C@H]3NCc4ccccc4[C@@H]3c2cc1O
BDBM50025883 Nc1ncnc2n(cnc12)C1CC(O)C(CO)O1
BDBM50032516 CCCN1Cc2c(C)cccc2[C@H]2[C@H]1CCc1cc(O)c(O)cc21
BDBM50032517 CCc1ccc2CN[C@@H]3CCc4cc(O)c(O)cc4[C@H]3c2c1
BDBM50032518 CCCN1Cc2cc(C)ccc2[C@H]2[C@H]1CCc1cc(O)c(O)cc21
BDBM50032519 Oc1cc2CC[C@H]3NCc4ccc(cc4[C@@H]3c2cc1O)-c1ccccc1
BDBM50032520 Cc1ccc2[C@H]3[C@@H](CCc4cc(O)c(O)cc34)NCc2c1
BDBM50032521 Oc1ccc2CN[C@@H]3CCc4cc(O)c(O)cc4[C@H]3c2c1
BDBM50032522 Cc1ccc2CN[C@@H]3CCc4cc(O)c(O)cc4[C@H]3c2c1
BDBM50032523 Cc1cccc2[C@H]3[C@@H](CCc4cc(O)c(O)cc34)NCc12
BDBM50032524 Oc1ccc2[C@H]3[C@@H](CCc4cc(O)c(O)cc34)NCc2c1
BDBM50050489 O=C(c1cn(CCN2CCOCC2)c2cc(ccc12)N=C=S)c1cccc2ccccc12
BDBM50050491 Cc1c(C(=O)c2ccc(N=C=S)c3ccccc23)c2ccccc2n1CCN1CCOCC1
BDBM50140057 CC1OC(CC1O)n1cnc2c(N)ncnc12
BDBM50370376 Nc1nc(F)nc2n(cnc12)[C@H]1C[C@H](O)[C@@H](CO)O1 |r|