BindingDB logo
myBDB logout

1 SMILES String for Adenylate kinase 4

Compound NameSMILES String
BDBM50010316 O[C@@H]1[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]([C@@H]1O)n1cnc2c(NCCCCCNC(=O)CI)ncnc12 |r|