BindingDB logo
myBDB logout

2 SMILES Strings for Adenylate kinase isoenzyme 1

Compound NameSMILES String
BDBM50277972 Nc1ncnc2n(CCc3ccccc3)c(nc12)-c1ccc(o1)P(O)(O)=O
BDBM50277565 CC(C)(C)Cn1c(nc2c(N)ncnc12)-c1ccc(o1)P(O)(O)=O