BindingDB logo
myBDB logout

3 SMILES Strings for Adenylosuccinate synthetase 2

Compound NameSMILES String
BDBM50149203 O[C@@H]1[C@@H](COP(O)(O)=O)O[C@@]2(NC(=O)NC2=O)[C@@H]1O |r|
BDBM50149229 O[C@@H]1[C@@H](COP(O)(O)=O)O[C@@]2(NC(=O)N(CCC[C@H](N(O)C=O)C(O)=O)C2=O)[C@@H]1O
BDBM50149248 ON(CC(O)=O)C=O