BindingDB logo
myBDB logout

39 SMILES Strings for Adrenaline alpha2

Compound NameSMILES String
BDBM7966 NCCc1cnc[nH]1
BDBM10755 NCCc1c[nH]c2ccc(O)cc12
BDBM16173 NC(=N)NC(=O)c1nc(Cl)c(N)nc1N
BDBM35938 CN(C)CCC(c1ccc(Cl)cc1)c1ccccn1
BDBM35229 CNCCCN1c2ccccc2CCc2ccccc12
BDBM39344 CCN(CC)CCNC(=O)c1ccc(N)cc1
BDBM39687 CCN1\C(=C\c2ccc3ccccc3[n+]2CC)C=Cc2ccccc12 |c:19|
BDBM55121 NCCc1ccc(O)c(O)c1
BDBM82070 CN1CCC[C@H]1c1cccnc1 |r|
BDBM81945 C[n+]1ccc(cc1)-c1ccccc1
BDBM86278 CN1CCc2c(Cl)c(O)c(O)cc2[C@@H](C1)c1cccc(C)c1 |r|
BDBM86694 ONC=Nc1ccc(N2CCOCC2)c(Cl)c1 |w:3.3|
BDBM50010859 CN(C)CCCN1c2ccccc2CCc2ccccc12
BDBM50014407 C1CN(CCN1)c1ccc2ccccc2n1
BDBM50017674 CN(C)CCOC(c1ccccc1)c1ccccc1
BDBM50017681 COc1ccc2nccc([C@H](O)C3CC4CCN3CC4C=C)c2c1 |TLB:10:12:18.19:16.15,20:19:12.13:16.15|
BDBM50029050 CNC[C@H](O)c1ccc(O)c(O)c1 |r|
BDBM50028893 CC(C)N(CCC(C(N)=O)(c1ccccc1)c1ccccn1)C(C)C
BDBM50028111 N[Pt](N)(Cl)Cl
BDBM50026220 C[N+](C)(C)CCO
BDBM50033369 NC12CC3CC(CC(C3)C1)C2 |THB:6:5:2:8.7.9,6:7:4.5.10:2,9:7:4:10.1.2,9:1:4:8.6.7,0:1:4:8.6.7|
BDBM50079455 C[N+](C)(C)C
BDBM50149890 CC[N+](CC)(CC)CC
BDBM50151860 CCN(CC)CCNC(=O)c1ccc(NC(C)=O)cc1
BDBM50170653 C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]1CC[C@@H]2C(=O)CO |r,t:9|
BDBM50206509 CCCN(CCC)S(=O)(=O)c1ccc(cc1)C(O)=O
BDBM50270006 Nc1ccc(cc1)C(=O)NCC([O-])=O
BDBM50303766 OC(=O)CCC(=O)C(O)=O
BDBM50373877 Cc1c(CCO)sc[n+]1Cc1cnc(C)nc1N
BDBM50367247 COc1ccc2nccc([C@@H](O)[C@@H]3C[C@@H]4CCN3C[C@@H]4C=C)c2c1 |THB:20:19:12.13:16.15,10:12:19.18:16.15|
BDBM50403559 CNC(NCCSCc1[nH]cnc1C)=NC#N |w:14.15|
BDBM50420177 CNC(=O)c1cccnc1
BDBM50420178 NC(N)=N
BDBM50420192 CC[n+]1c(CC2C=C(C)N=C(N2C)c2ccccc2)ccc2ccccc12 |c:9,t:6|
BDBM50420215 CC(C)N1\C(=C/c2cc[n+](C(C)C)c3ccccc23)C=Cc2ccccc12 |c:21|
BDBM50420216 CC(C)C(C(O)CC[N+]1(C)CCCCC1)c1ccccc1