BindingDB logo
myBDB logout

24 SMILES Strings for Advanced glycosylation end product-specific receptor

Compound NameSMILES String
BDBM50005629 CCCCOc1cc(OCCCN(CC)CC)ccc1NC(=O)c1cc(nn1C)-c1ccc(OC2CCCCC2)cc1
BDBM50005631 CCCCOc1cc(OCCCN(CC)CC)ccc1NC(=O)c1cc(nn1C)-c1ccc(Oc2ccccn2)cc1
BDBM50005633 CCCCOc1cc(OCCCN(CC)CC)ccc1NC(=O)c1cc(nn1C)-c1ccc(Oc2ccc(cc2)C(F)(F)F)cc1
BDBM50005632 CCCCOc1cc(OCCCN(CC)CC)ccc1NC(=O)c1cc(nn1C)-c1ccc(Oc2ccc(OC)cc2)cc1
BDBM50005634 CCCCOc1cc(OCCCN(CC)CC)ccc1NC(=O)c1cc(nn1C)-c1ccc(Oc2ccc(F)cc2)cc1
BDBM50005630 CCCCOc1cc(OCCCN(CC)CC)ccc1NC(=O)c1cc(nn1C)-c1ccc(Oc2ccccc2)cc1
BDBM50005635 CCCCOc1cc(OCCCN(CC)CC)ccc1NC(=O)c1cc(nn1C)-c1ccc(Oc2ccc(Cl)c(OC)c2)cc1
BDBM50397836 CCN(CC)CCOc1cccc(Nc2nc(cc(n2)-c2ccc(Cl)cc2)-c2ccc(Cl)cc2)c1
BDBM50397837 CCN(CC)CCOc1ccccc1Nc1nc(cc(n1)-c1ccc(Cl)cc1)-c1ccc(Cl)cc1
BDBM50402561 CCCCc1sc(nc1-c1ccc(Oc2ccc(Cl)cc2)cc1)-c1ccc(OCCN(CC)CC)cc1
BDBM50402562 CCCCc1sc(nc1-c1ccc(Oc2ccc(Cl)cc2)cc1)-c1ccc(OCCN(C)C)cc1
BDBM50402563 CCCCc1sc(nc1-c1ccc(Oc2ccc(Cl)cc2)cc1)-c1ccc(OCCN2CCN(C)CC2)cc1
BDBM50402564 CCCCc1sc(nc1-c1ccc(Oc2ccc(Cl)cc2)cc1)-c1ccc(OCCN2CCCCC2)cc1
BDBM50402565 CCCCc1sc(nc1-c1ccc(Oc2ccc(Cl)cc2)cc1)-c1ccc(OCCN2CCCC2)cc1
BDBM50402566 CCCCc1sc(nc1-c1ccc(Oc2ccc(Cl)cc2)cc1)-c1ccc(OCCCN2CCN(C)CC2)cc1
BDBM50402567 CCCCc1sc(nc1-c1ccc(Oc2ccc(Cl)cc2)cc1)-c1ccc(OCCCN2CCCCC2)cc1
BDBM50402568 CCCCc1sc(Nc2ccc(OCCCN(CC)CC)cc2)nc1-c1ccc(Oc2ccc(Cl)cc2)cc1
BDBM50402569 CCCCc1sc(NC(=O)c2ccc(OCCCN(CC)CC)cc2)nc1-c1ccc(Oc2ccc(Cl)cc2)cc1
BDBM50402570 CCCCc1nc(sc1-c1ccc(OCC2CCCN(CC)C2)cc1)-c1ccc(Oc2ccc(Cl)cc2)cc1
BDBM50402571 CCCCc1nc(sc1-c1ccc(OCCCN(CC)CC)cc1)-c1ccc(Oc2ccc(Cl)cc2)cc1
BDBM50402572 CCCCc1sc(nc1-c1ccc(Oc2ccc(Cl)cc2)cc1)-c1ccc(OCC2CCCN(CC)C2)cc1
BDBM50402573 CCCCc1sc(nc1-c1ccc(Oc2ccc(Cl)cc2)cc1)-c1ccc(OCCCN(CC)CC)cc1
BDBM50402574 CCCCc1sc(nc1-c1ccc(OCC2CCCN(CC)C2)cc1)-c1ccc(Oc2ccc(Cl)cc2)cc1
BDBM50402575 CCCCc1sc(nc1-c1ccc(OCCCN(CC)CC)cc1)-c1ccc(Oc2ccc(Cl)cc2)cc1