BindingDB logo
myBDB logout

22 SMILES Strings for Agp1p

Compound NameSMILES String
BDBM31063 CS(=O)(=O)c1nc(cc(n1)C(F)(F)F)-c1ccccc1
BDBM31068 CS(=O)(=O)c1nc(cc(n1)C(F)(F)F)-c1cccs1
BDBM34183 CCOC(=O)CS(=O)(=O)c1nc(cc(n1)C(F)(F)F)-c1ccccc1
BDBM41480 CC(=O)c1ccc(N2CCN(CC2)C(=O)c2ccc(Br)cc2)c(F)c1
BDBM43506 CCOC(=O)CCS(=O)(=O)c1nc(cc(n1)C(F)(F)F)-c1ccccc1
BDBM43513 COC(=O)CCS(=O)(=O)c1nc(cc(n1)C(F)(F)F)-c1ccccc1
BDBM41600 [O-][N+](=O)c1cccc(c1)C#CC(=O)c1ccccc1
BDBM55139 Fc1ccc(cc1)-c1nn(cc1C=c1c(=C)[nH][nH]c1=O)-c1ccccc1 |w:12.13|
BDBM58019 Cc1ccc(o1)C(=O)Nc1nc(cs1)-c1ccccn1
BDBM60229 CCCOc1ccc(cc1)C(=O)NNC(=S)NC(=O)CC
BDBM61536 CC(C)(C)C(=O)C(Cl)C(=O)Nc1ccccc1
BDBM66017 Cc1cccc(C)c1NC(=O)C(Cl)C(=O)c1ccccc1
BDBM66024 Clc1ccc2c(OC(=O)N3CCCCCC3)ccnc2c1
BDBM66025 CN1CCN(CC1)C=Nc1c(C#N)c(c(-c2ccccc2)n1Cc1ccco1)-c1ccccc1
BDBM66026 Cc1ccc(cc1)S(=O)(=O)N=C(Sc1ccccc1)c1ccccc1
BDBM66027 COc1ccc(N2CCN(CC2)C(=O)c2ccc(Br)cc2)c(c1)[N+]([O-])=O
BDBM65982 O=C(COC(=O)c1cc(nc2ccccc12)-c1ccccc1)N1CCN(CC1)C(=O)c1ccco1
BDBM66028 CCN(CC)C(=O)Oc1ccnc2cc(Cl)ccc12
BDBM65986 Brc1cccc(c1)-c1cc(C(=O)OCC(=O)N2CCN(CC2)C(=O)c2ccco2)c2ccccc2n1
BDBM66002 CN1CCN(CC1c1ccccc1)C(=O)c1cc(COc2c(F)cccc2F)on1
BDBM66010 CNc1nc(N)c(c(Nc2cccc(F)c2)n1)[N+]([O-])=O
BDBM76252 Nc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1[N+]([O-])=O