BindingDB logo
myBDB logout

18 SMILES Strings for Ah Receptor

Compound NameSMILES String
BDBM23927 Clc1cc2Oc3cc(Cl)c(Cl)cc3Oc2cc1Cl
BDBM92704 Clc1cc2Oc3cc(Cl)c(Cl)cc3Oc2c(c1)N=[N]#N
BDBM92705 Clc1cc2Oc3cc(Cl)c(I)c(N=[N]#N)c3Oc2cc1Cl
BDBM92706 Clc1cc2Oc3cc(Cl)c(cc3Oc2cc1Cl)N=[N]#N
BDBM92707 Brc1cc2Oc3cc(I)c(cc3Oc2cc1Br)N=[N]#N
BDBM92708 Clc1cc2Oc3cc(Cl)c(Cl)c(CNC(=O)c4cc(ccc4N(=O)=O)N=[N]#N)c3Oc2cc1Cl
BDBM92709 Clc1cc2Oc3cc(Cl)c(Cl)c(CNC(=O)c4ccc(cc4)N=[N]#N)c3Oc2cc1Cl
BDBM92710 Oc1cc(ccc1C(=O)NCc1c(Cl)c(Cl)cc2Oc3cc(Cl)c(Cl)cc3Oc12)N=[N]#N
BDBM92711 Clc1cc2Oc3cc(Cl)c(Cl)c(CNC(=O)CCCCCNc4ccc(cc4N(=O)=O)N=[N]#N)c3Oc2cc1Cl
BDBM50357322 CN(C)C\C=C\C(=O)N(C)c1ccc2nc(Nc3cc(F)ccc3C)c3cncn3c2c1
BDBM50357333 CN(C)C\C=C\C(=O)N(C)c1cc2c(cc1F)nc(Nc1ccccc1C)c1cncn21
BDBM50357339 CN(C)C\C=C\C(=O)N(C)c1cc2c(cc1Cl)nc(Nc1cc(F)ccc1C)c1cncn21
BDBM50357344 CN(C)C\C=C\C(=O)N(C)c1ccc2nc(Oc3ccc(F)cc3C)c3cncn3c2c1
BDBM50015301 Clc1ccc(-c2nc(no2)-c2ccccc2)c(Cl)c1
BDBM50015302 Nc1cc(Cl)ccc1-c1nc(no1)-c1ccccc1
BDBM50015303 [O-][N+](=O)c1cc(F)ccc1-c1nc(no1)-c1ccccc1
BDBM50015304 Nc1cc(ccc1-c1nc(no1)-c1ccccc1)C(F)(F)F
BDBM50015305 Clc1ccc(-c2nc(no2)-c2ccccc2)c(Cl)c1Cl