BindingDB logo
myBDB logout

1 SMILES String for Alcohol sulfotransferase

Compound NameSMILES String
BDBM50051828 Cc1c(-c2ccc(OS([O-])(=O)=O)cc2)n(Cc2c(F)c(F)c(F)c(F)c2F)c2cc(OS([O-])(=O)=O)cc(c12)C(F)(F)F