BindingDB logo
myBDB logout

4 SMILES Strings for Aldehyde dehydrogenase

Compound NameSMILES String
BDBM50058655 CCN(CC)C(=S)SSC(=S)N(CC)CC
BDBM50172756 CN(CC#C)Cc1ccccc1
BDBM50292380 OC[C@H]1OC([C@H](O)[C@@H](O)[C@@H]1O)C1(c2ccc3C(=O)c4cc(CO)cc(O)c4C(=O)c3c2O)c2cccc(O)c2C(=O)c2c(O)cc(CO)cc12 |r|
BDBM50414919 CN1CCN(CC1)C(=S)SSC(=S)N1CCN(C)CC1