BindingDB logo
myBDB logout

25 SMILES Strings for Aldehyde dehydrogenase 1A1

Compound NameSMILES String
BDBM11365 CS(=O)(=O)NO
BDBM11372 ONS(=O)(=O)c1ccccc1
BDBM50003041 O=C(ON(C#N)C(=O)c1ccccc1)c1ccccc1
BDBM50003042 CC(=O)ON(C(C)=O)S(=O)(=O)c1ccc(Cl)cc1
BDBM50035003 CCOC(=O)ON1C(=O)c2ccccc2S1(=O)=O
BDBM50035004 CCOC(=O)ON1C(=O)CCC1=O
BDBM50034996 CC(=O)ON1C(=O)c2ccccc2S1(=O)=O
BDBM50034997 ON1C(=O)c2ccccc2S1(=O)=O
BDBM50034998 COC(=O)ON(C(=O)OC)S(=O)(=O)c1ccc(Cl)cc1
BDBM50034999 CCOC(=O)ON1C(=O)c2ccccc2C1=O
BDBM50035000 CCOC(=O)OC(=O)OCC
BDBM50035001 CCOC(=O)On1nnc2ccccc12
BDBM50035002 CCOC(=O)ON(C(=O)OCC)S(=O)(=O)c1ccc(Cl)cc1
BDBM50065927 CON(C(=O)OC)S(C)(=O)=O
BDBM50065928 COC(=O)ON(C(=O)OC)S(C)(=O)=O
BDBM50065929 CC(=O)ON(c1ccccc1)S(=O)(=O)c1ccccc1
BDBM50065930 CC(=O)ON(C(C)=O)S(C)(=O)=O
BDBM50065931 CON(c1ccccc1)S(=O)(=O)c1ccccc1
BDBM50065932 CCOC(=O)ON(C(=O)OCC)S(C)(=O)=O
BDBM50065933 ON(c1ccccc1)S(=O)(=O)c1ccccc1
BDBM50065934 ON(C(=O)C(F)(F)F)c1ccccc1
BDBM50065935 O=Nc1ccccc1
BDBM50065936 CCOC(=O)ON(c1ccccc1)S(=O)(=O)c1ccccc1
BDBM50065926 COC(=O)ON(c1ccccc1)S(=O)(=O)c1ccccc1
BDBM50081534 CCOC(=O)N(OC(=O)N(CC)CC)S(=O)(=O)c1ccccc1