BindingDB logo
myBDB logout

7 SMILES Strings for Aldehyde dehydrogenase X, mitochondrial

Compound NameSMILES String
BDBM65735 CCCCn1c(CN2CCN(CC2)c2cccc(Cl)c2)nc2n(C)c(=O)n(C)c(=O)c12
BDBM50076544 CCCCn1c(CN2CCN(CC2)c2ccc(OC)cc2)nc2n(C)c(=O)n(C)c(=O)c12
BDBM50076552 CC(C)CCn1c(CN(C)Cc2ccccc2)nc2n(C)c(=O)n(C)c(=O)c12
BDBM50076553 CC(C)CCn1c(CN2CCOCC2)nc2n(C)c(=O)n(C)c(=O)c12
BDBM50076670 Cc1ccc(Cn2c(CN3CCN(CC3)c3ccccc3)nc3n(C)c(=O)n(C)c(=O)c23)cc1
BDBM50076740 Cn1c2nc(CN3CCC(CC3)C(N)=O)n(CCCc3ccccc3)c2c(=O)n(C)c1=O
BDBM50076551 CC(C)CCn1c(CN2CCC(C)CC2)nc2n(C)c(=O)n(C)c(=O)c12