BindingDB logo
myBDB logout

27 SMILES Strings for Aldehyde oxidase

Compound NameSMILES String
BDBM17292 [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])c3ccc(O)cc3CC[C@@]21[H]
BDBM19441 Oc1ccc(cc1)-c1sc2cc(O)ccc2c1C(=O)c1ccc(OCCN2CCCCC2)cc1
BDBM20625 CC\C(=C(\CC)c1ccc(O)cc1)c1ccc(O)cc1
BDBM19459 Oc1ccc(cc1)-c1coc2cc(O)cc(O)c2c1=O
BDBM22889 CNC(NC#N)=NCCSCc1[nH]cnc1C |w:6.6|
BDBM24778 CC1=CC(=O)c2ccccc2C1=O |t:1|
BDBM82507 CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1
BDBM86521 CCN(C(C)=O)c1cccc(c1)-c1ccnc2c(cnn12)C#N
BDBM87351 COc1cc(NS(C)(=O)=O)ccc1Nc1c2ccccc2nc2ccccc12
BDBM50001884 CN1CCN(CC1)C1=Nc2cc(Cl)ccc2Nc2ccccc12 |t:8|
BDBM50001888 CN(C)CCCN1c2ccccc2Sc2ccc(Cl)cc12
BDBM50017716 CCCC(C(=O)OCCN(CC)CC)(c1ccccc1)c1ccccc1
BDBM50015214 CCN(CC)CCCC(C)Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12
BDBM50130273 OCCN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc23)CC1
BDBM50187243 C[C@]12CC[C@H]3[C@@H](CCc4cc(O)ccc34)[C@@H]1CC[C@@]2(O)C#C |r|
BDBM50240367 COc1ccc(C=O)cc1O
BDBM50241107 Clc1ccc2n(C3CCN(CCCn4c5ccccc5[nH]c4=O)CC3)c(=O)[nH]c2c1
BDBM50332780 CN(C)CCNC(=O)c1cccc2cc3cc(O)ccc3nc12
BDBM50332779 c1nc2ncnc(N=Nc3ncnc4nc[nH]c34)c2[nH]1 |w:7.6|
BDBM50366975 CCOC(CP(=O)(OCC)OCC)OCC
BDBM50366976 CCOC(CCP(=O)(OCC)OCC)OCC
BDBM50366977 CCOP(=O)(CC=O)OCC
BDBM50366978 CCOP(=O)(CCC=O)c1ccccc1
BDBM50366979 Cc1ncc(CO)c(C=O)c1O
BDBM50366980 CCOC(CCP(=O)(OCC)c1ccccc1)OCC
BDBM50366981 CCOC(CP(=O)(OCC)c1ccccc1)OCC
BDBM50366982 CCOP(=O)(CCC=O)OCC