BindingDB logo
myBDB logout

11 SMILES Strings for Aldehyde oxidase (AO)

Compound NameSMILES String
BDBM4078 Oc1cc2c3c(oc(=O)c4cc(O)c(O)c(oc2=O)c34)c1O
BDBM19461 Oc1ccc(cc1)C1CC(=O)c2c(O)cc(O)cc2O1
BDBM24778 CC1=CC(=O)c2ccccc2C1=O |t:1|
BDBM175344 [O-][N+](=O)C1Oc2ccccc2C1=O
BDBM175345 [O-][N+](=O)c1cccc2OC(=O)Cc12
BDBM175346 OC1Oc2ccccc2C1=O
BDBM175347 OC1Oc2cccc(O)c2C1=O
BDBM175348 OC1Oc2ccc(O)cc2C1=O
BDBM175349 CC(C)c1cccc2OC(=O)Cc12
BDBM175350 Oc1ccc2C(=O)\C(Oc2c1)=C\c1ccc(O)c(O)c1O
BDBM175351 Oc1ccc2C(=O)\C(Oc2c1)=C\c1cc(O)c(O)c(O)c1