BindingDB logo
myBDB logout

18 SMILES Strings for Aldehyde reductase (ALR1)

Compound NameSMILES String
BDBM50003616 CCCC(CCC)C(O)=O
BDBM193848 C\C(=N/Nc1nc(cs1)-c1cc2ccccc2oc1=O)c1ccccc1
BDBM193850 C\C(=N/Nc1nc(cs1)-c1cc2ccccc2oc1=O)c1ccccc1Br
BDBM193851 C\C(=N/Nc1nc(cs1)-c1cc2ccccc2oc1=O)c1cccc(Br)c1
BDBM193852 C\C(=N/Nc1nc(cs1)-c1cc2ccccc2oc1=O)c1ccc(Br)cc1
BDBM193853 C\C(=N/Nc1nc(cs1)-c1cc2ccccc2oc1=O)c1ccccc1F
BDBM193855 COc1ccc(cc1)C(\C)=N\Nc1nc(cs1)-c1cc2ccccc2oc1=O
BDBM193856 COc1ccc(cc1F)C(\C)=N\Nc1nc(cs1)-c1cc2ccccc2oc1=O
BDBM193857 COc1ccc(\C(C)=N\Nc2nc(cs2)-c2cc3ccccc3oc2=O)c(O)c1
BDBM193858 COc1cc(ccc1O)C(\C)=N\Nc1nc(cs1)-c1cc2ccccc2oc1=O
BDBM193859 COc1ccc(cc1I)C(\C)=N\Nc1nc(cs1)-c1cc2ccccc2oc1=O
BDBM193861 O=c1oc2ccccc2cc1-c1csc(-[#7]\[#7]=[#6](\c2ccccc2)-c2ccccc2)n1
BDBM193862 C\C(=N/Nc1nc(cs1)-c1cc2ccccc2oc1=O)c1cc2ccccc2oc1=O
BDBM193864 CCCCNCn1nc(oc1=S)-c1cc2ccccc2oc1=O
BDBM193865 Cc1ccc(NCn2nc(oc2=S)-c2cc3ccccc3oc2=O)cc1
BDBM193867 Clc1cccc(NCn2nc(oc2=S)-c2cc3ccccc3oc2=O)c1
BDBM193868 Clc1ccc(NCn2nc(oc2=S)-c2cc3ccccc3oc2=O)cc1
BDBM193860 C\C(=N/Nc1nc(cs1)-c1cc2ccccc2oc1=O)c1ccc(Cl)cc1N