BindingDB logo
myBDB logout

12 SMILES Strings for Aldose Reductase (ALR2) Mutant (C298A/W219Y)

Compound NameSMILES String
BDBM16419 OC(=O)Cc1ccccc1
BDBM16422 OC(=O)Cc1ccccc1F
BDBM16423 Cc1ccccc1CC(O)=O
BDBM16424 OC(=O)Cc1ccccc1Cl
BDBM16425 OC(=O)Cc1ccccc1Br
BDBM16426 OC(=O)Cc1ccccc1O
BDBM16427 OC(=O)Cc1ccc(Cl)cc1
BDBM16428 OC(=O)Cc1c(F)cccc1F
BDBM16429 OC(=O)Cc1c(Cl)cccc1Cl
BDBM16430 OC(=O)\C=C\c1ccccc1
BDBM16431 OC(=O)Cc1ccc2ccccc2c1
BDBM16415 OC(=O)CN1C(=O)c2cccc3cccc(C1=O)c23