BindingDB logo
myBDB logout

1 SMILES String for Aldose reductase L301M (AR)

Compound NameSMILES String
BDBM16312 Fc1ccc2OCC[C@]3(NC(=O)NC3=O)c2c1 |r|