BindingDB logo
myBDB logout

9 SMILES Strings for Aldose reductase-related protein 1

Compound NameSMILES String
BDBM16452 OC(=O)Cc1nn(Cc2nc3cc(ccc3s2)C(F)(F)F)c(=O)c2ccccc12
BDBM50003616 CCCC(CCC)C(O)=O
BDBM50080465 CC(C)Sc1nnc2c3ccccc3n(CC(O)=O)c2n1
BDBM50080537 CC(C)(C)C(=O)c1cn(CC(O)=O)c2ccccc12
BDBM50080471 OC(=O)Cn1c2ccccc2c2nc3ccccc3nc12
BDBM50080469 CCCNC(=O)CSc1nnc2c3cc(C)ccc3n(CC(O)=O)c2n1
BDBM50080538 OC(=O)Cn1ccc2ccccc12
BDBM50080472 OC(=O)Cn1c2CCCc2c2ccccc12
BDBM50080464 OC(=O)Cn1c2ccccc2c2nnc(S)nc12