BindingDB logo
myBDB logout

1 SMILES String for Alkaline phosphatase, placental-like

Compound NameSMILES String
BDBM50447413 Cc1ccc(C)c(NC(=O)CNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c1