BindingDB logo
myBDB logout

64 SMILES Strings for Alkaline phosphatase placental type

Compound NameSMILES String
BDBM76212 COc1ccccc1CNC(=O)CCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1
BDBM76213 COc1cccc(CNC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c1
BDBM76214 Cc1ccc(C)c(NC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c1
BDBM76215 O=C(CCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1)Nc1cccc(c1)C#N
BDBM50080274 OP(O)(=O)Cc1ccccc1
BDBM50241179 C1CN2C[C@@H](N=C2S1)c1ccccc1 |r,c:5|
BDBM50253982 OCCNC(=O)c1cc(n[nH]1)-c1ccc(Cl)c(Cl)c1Cl
BDBM50443973 Nc1ccc2sc(cc2c1)C1CN2C=CSC2=N1 |c:15,19|
BDBM50443975 C1CN2CC(N=C2S1)c1cc2ccccc2s1 |c:5|
BDBM50443976 C1C(N=C2SC=CN12)c1cc2ccccc2s1 |c:5,t:2|
BDBM50443974 [O-][N+](=O)c1ccc2sc(cc2c1)C1Cn2ccs[c+]2[N-]1
BDBM50447412 COc1cccc(CNC(=O)NS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c1
BDBM50447413 Cc1ccc(C)c(NC(=O)CNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c1
BDBM50447415 COc1ccc(NC(=O)CCCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1OC
BDBM50447416 Cc1ccccc1CNC(=O)CCCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1
BDBM50447417 Clc1ccccc1NC(=O)CCCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1
BDBM50447418 COc1ccc(CNC(=O)CCCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1OC
BDBM50447419 O=C(CCCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1)NCc1ccc2OCOc2c1
BDBM50447420 COc1ccc(CNC(=O)CCCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c(OC)c1
BDBM50447421 Fc1cccc(CNC(=O)CCCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c1
BDBM50447422 COc1ccc(NC(=O)CCCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c(OC)c1
BDBM50447423 COc1ccc(CCNC(=O)CCCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1
BDBM50447424 Oc1ccc(CCNC(=O)CCCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1
BDBM50447425 COc1ccccc1CNC(=O)CCCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1
BDBM50447426 COc1ccc(CCNC(=O)CCCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1OC
BDBM50447427 O=C(NCCc1ccc2OCOc2c1)NS(=O)(=O)c1ccc2[nH]c(=O)oc2c1
BDBM50447428 Clc1cccc(CNC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c1
BDBM50447429 Clc1ccccc1CNC(=O)CCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1
BDBM50447430 FC(F)(F)c1ccc(CNC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1
BDBM50447431 Oc1ccc(CNC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1
BDBM50447432 Fc1ccccc1NC(=O)CCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1
BDBM50447435 Cc1ccc(C)c(NC(=O)CCNS(=O)(=O)c2ccc3n(C)c(=O)oc3c2)c1
BDBM50447436 Fc1ccc(CNC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1
BDBM50447437 Cc1ccc(CNC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1
BDBM50447438 Clc1ccc(CNC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1
BDBM50447439 Cc1ccc(NC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1C
BDBM50447440 O=C(CCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1)NCc1ccccc1
BDBM50447441 FC(F)(F)c1cccc(CNC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c1
BDBM50447442 O=C(CCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1)NCCCc1ccc2OCOc2c1
BDBM50447443 O=C(CCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1)NCCc1ccc2OCOc2c1
BDBM50447444 Fc1cccc(CNC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c1
BDBM50447445 O=C(CCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1)Nc1ccc2OCOc2c1
BDBM50447446 Oc1ccc(CNC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1O
BDBM50447447 O=C(CCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1)NCc1ccc2OCOc2c1
BDBM50447448 COc1ccc(CNC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1
BDBM50447449 O=C(CCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1)NCc1cccc(c1)C#N
BDBM50447450 COc1ccc(NC(=O)CCNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1OC
BDBM50447452 O=C(CNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1)NCc1ccc2OCOc2c1
BDBM50447453 O=C(CNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1)NCCc1ccc2OCOc2c1
BDBM50447454 COc1ccc(CNC(=O)CNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c(OC)c1
BDBM50447455 O=C(CNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1)Nc1cccc(c1)C#N
BDBM50447456 O=C(CNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1)Nc1ccc(cc1)C#N
BDBM50447457 COc1ccc(CNC(=O)CNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1
BDBM50447458 COc1cccc(CNC(=O)CNS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c1
BDBM50447459 O=C(Nc1ccc2OCOc2c1)NS(=O)(=O)c1ccc2[nH]c(=O)oc2c1
BDBM50447460 COc1ccc(NC(=O)NS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1OC
BDBM50447461 Cc1ccc(C)c(NC(=O)NS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c1
BDBM50447462 O=C(Nc1ccc(cc1)C#N)NS(=O)(=O)c1ccc2[nH]c(=O)oc2c1
BDBM50447463 O=C(Nc1cccc(c1)C#N)NS(=O)(=O)c1ccc2[nH]c(=O)oc2c1
BDBM50447464 COc1ccc(CNC(=O)NS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)cc1
BDBM50447465 COc1ccc(CNC(=O)NS(=O)(=O)c2ccc3[nH]c(=O)oc3c2)c(OC)c1
BDBM50150070 C1C(N=C2SC=CN12)c1cc2ccccc2o1 |c:5,t:2|
BDBM50150071 OC(Cn1ccsc1=N)c1cc2ccccc2o1
BDBM50150089 N=c1sccn1CC(=O)c1cc2ccccc2o1