BindingDB logo
myBDB logout

4 SMILES Strings for Alkaline phosphatase tissue-nonspecific

Compound NameSMILES String
BDBM14363 CCCOc1ccccc1-c1nc2nn[nH]c2c(=O)[nH]1
BDBM50131864 CCCP(O)(O)=O
BDBM50131868 OC(=O)c1cccc2ccc(CP(O)(O)=O)cc12
BDBM50404870 OC(=O)c1ccc2nc3ccc(O)cc3c(=O)n2c1