BindingDB logo
myBDB logout

12 SMILES Strings for Alpha glucosidase

Compound NameSMILES String
BDBM19459 Oc1ccc(cc1)-c1coc2cc(O)cc(O)c2c1=O
BDBM50076963 CN1CC(O)C(O)C(O)C1CO
BDBM50219337 OC[C@@H](OS([O-])(=O)=O)[C@@H](O)C[S@@+]1C[C@@H](O)[C@H](O)[C@@H]1CO
BDBM50283598 NC1C(O)C(O)C(O)C1(O)CO
BDBM50283599 OCC1(O)C(O)C(O)C2(CO)OCC(Nc3ccccc3)=NC12 |c:21|
BDBM50283600 NC1C(O)C(O)C(O)C1O
BDBM50283601 OC1C(O)C2OC(Nc3ccccc3)=NC2C1O |c:14|
BDBM50283602 OCC12OC(Nc3ccccc3)=NC1C(O)C(O)C2O |c:12|
BDBM50283603 OCC1C(O)C(O)C2OC(Nc3ccccc3)=NC12 |c:17|
BDBM50283604 OCC1(O)C(O)C(O)C2N=C(Nc3ccccc3)OC12 |t:9|
BDBM50350757 OC[C@@H]1CNC[C@@H](O)[C@@H]1O |r|
BDBM50226273 OCN(CO)[C@H]1C[C@](O)(CO)[C@@H](O)[C@H](O)[C@H]1O |r|