BindingDB logo
myBDB logout

7 SMILES Strings for Alpha-(1,3)-fucosyltransferase 9

Compound NameSMILES String
BDBM92459 Nc1nc2n(cnc2c(=O)[nH]1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O
BDBM50370754 Nc1nc2N(CNc2c(=O)[nH]1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O
BDBM50035293 [Na+].Nc1nc2n(cnc2c(=O)[nH]1)[C@@H]1O[C@H](COP([O-])(=O)OP(O)(=O)OCc2cn(nn2)[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O |r|
BDBM50035294 [Na+].C[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@H]1O)n1cc(COP(O)(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)n2cnc3c2nc(N)[nH]c3=O)nn1 |r|
BDBM50035295 [Na+].C[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@@H]1O)n1cc(COP(O)(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)n2cnc3c2nc(N)[nH]c3=O)nn1 |r|
BDBM50035296 NC[C@@H]1O[C@H](OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)n2cnc3c2nc(N)[nH]c3=O)[C@@H](O)[C@H](O)[C@@H]1O |r|
BDBM50035297 Nc1nc2n(cnc2c(=O)[nH]1)[C@H]1C[C@H](O)[C@@H](CO[P@@](O)(=O)OP(O)(O)=O)O1 |r|