BindingDB logo
myBDB logout

8 SMILES Strings for Alpha-(1,3)-fucosyltransferase IV

Compound NameSMILES String
BDBM92459 Nc1nc2n(cnc2c(=O)[nH]1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O
BDBM50070942 Oc1cc(O)c2C[C@@H](OC(=O)c3cc(O)c(O)c(O)c3)[C@H](Oc2c1)c1cc(O)c(O)c(O)c1 |r|
BDBM50085536 OC(=O)c1cc(O)c(O)c(O)c1
BDBM50366916 Nc1nc2n(cnc2c(=O)[nH]1)C1O[C@H](COP(O)(=O)OP(O)(=O)OCc2cn(CCCCC(=O)Nc3ccc4c(O)c5ccccc5c(O)c4c3)nn2)[C@@H](O)[C@H]1O |r|
BDBM50366917 Nc1nc2n(cnc2c(=O)[nH]1)C1O[C@H](COP(O)(=O)OP(O)(=O)OCc2cn(CCC(=O)NCc3cccc4ccccc34)nn2)[C@@H](O)[C@H]1O |r|
BDBM50366918 Nc1nc2n(cnc2c(=O)[nH]1)C1O[C@H](COP(O)(=O)OP(O)(=O)OCc2cn(CC(=O)NC(Cc3ccccc3)c3ccccc3)nn2)[C@@H](O)[C@H]1O |r|
BDBM50366919 Nc1nc2n(cnc2c(=O)[nH]1)C1O[C@H](COP(O)(=O)OP(O)(=O)OCc2cn(CCCCC(=O)NC(Cc3ccccc3)c3ccccc3)nn2)[C@@H](O)[C@H]1O |r|
BDBM50366920 Nc1nc2n(cnc2c(=O)[nH]1)C1O[C@H](COP(O)(=O)OP(O)(=O)OCc2cn(CCCC(=O)NC(Cc3ccccc3)c3ccccc3)nn2)[C@@H](O)[C@H]1O |r|