BindingDB logo
myBDB logout

11 SMILES Strings for Alpha-(1,3)-fucosyltransferase VII

Compound NameSMILES String
BDBM74208 OC(=O)c1ccc(O)cc1O
BDBM92456 OC(=O)c1cccc(O)c1O
BDBM92458 COc1cc(cc(OC)c1OC)C(O)=O
BDBM92459 Nc1nc2n(cnc2c(=O)[nH]1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O
BDBM50070942 Oc1cc(O)c2C[C@@H](OC(=O)c3cc(O)c(O)c(O)c3)[C@H](Oc2c1)c1cc(O)c(O)c(O)c1 |r|
BDBM50085536 OC(=O)c1cc(O)c(O)c(O)c1
BDBM50100861 OC(=O)c1ccc(O)c(O)c1
BDBM50187132 COc1cc(cc(OC)c1O)C(O)=O
BDBM50187133 COC(=O)c1cc(O)c(O)c(O)c1
BDBM50336487 COc1ccc(cc1OC)C(O)=O
BDBM50335808 OC(=O)c1cc(O)ccc1O