BindingDB logo
myBDB logout

3 SMILES Strings for Alpha-(2,3)-(N)-sialyltransferase

Compound NameSMILES String
BDBM92459 Nc1nc2n(cnc2c(=O)[nH]1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O
BDBM50070942 Oc1cc(O)c2C[C@@H](OC(=O)c3cc(O)c(O)c(O)c3)[C@H](Oc2c1)c1cc(O)c(O)c(O)c1 |r|
BDBM50085536 OC(=O)c1cc(O)c(O)c(O)c1