BindingDB logo
myBDB logout

60 SMILES Strings for Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase

Compound NameSMILES String
BDBM294276 CCCS(=O)(=O)NC1CN(C1)c1cc2C(Cc3ccccc3)C(COc2cc1F)NC
BDBM294271 CCCS(=O)(=O)NC1CN(C1)c1ccc2OC[C@@H](NC)[C@@H](Cc3ccccc3)c2c1
BDBM294256 CNC1COc2ccc(cc2C1Cc1ccccc1)N1CC(C1)NS(=O)(=O)CC1CC1
BDBM50433270 CCC1(C)NC(=O)c2cc(ccc2NC1=O)S(=O)(=O)Nc1ccc(OC)cc1
BDBM50433271 CCC1(C)NC(=O)c2cc(ccc2NC1=O)S(=O)(=O)Nc1ccccc1Cl
BDBM50433272 CCC1(C)NC(=O)c2cc(ccc2NC1=O)S(=O)(=O)Nc1ccc(Cl)cc1
BDBM50433273 CCC1(C)NC(=O)c2cc(ccc2NC1=O)S(=O)(=O)Nc1ccccc1
BDBM50433274 CC[C@]1(C)NC(=O)c2cc(ccc2NC1=O)S(=O)(=O)Nc1ccc(OC(F)F)cc1 |r|
BDBM50433278 CCC1(C)NC(=O)c2cc(ccc2N(C)C1=O)S(=O)(=O)Nc1ccc(Cl)cc1
BDBM50117659 COc1cccc(CC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)NCCc2cccc(F)c2)c1
BDBM50117665 COc1cccc(CC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)Nc2cnn(n2)C2CCC2)c1
BDBM294257 CCS(=O)(=O)NC1CN(C1)c1cc2[C@H](Cc3ccccc3)[C@@H](COc2cc1F)NC
BDBM294251 Fc1cc2OC[C@H]([C@@H](Cc3ccccc3)c2cc1N1CC(C1)NS(=O)(=O)c1cccnc1F)N1CCC1
BDBM294252 Fc1cc2OCC(C(Cc3ccccc3)c2cc1N1CC(C1)NS(=O)(=O)c1cccnn1)N1CCC1
BDBM294253 Fc1ncccc1S(=O)(=O)NC1CN(C1)c1ccc2OCC(C(Cc3ccccc3)c2c1)N1CCC1
BDBM294254 CCCS(=O)(=O)NC1CN(C1)c1ccc2OCC(NC)C(Cc3ccccc3)c2c1
BDBM294255 CCS(=O)(=O)NC1CN(C1)c1ccc2OCC(NC)C(Cc3ccccc3)c2c1
BDBM294258 CCS(=O)(=O)NC1CN(C1)c1cc2[C@@H](Cc3ccccc3)[C@@H](COc2cc1F)NC
BDBM294259 CN[C@@H]1COc2cc(F)c(cc2[C@@H]1Cc1ccccc1)N1CC(C1)NS(=O)(=O)c1cn(C)cn1
BDBM294260 CN[C@@H]1COc2cc(F)c(cc2[C@H]1Cc1ccccc1)N1CC(C1)NS(=O)(=O)c1cn(C)cn1
BDBM294261 CCCS(=O)(=O)NC1CN(C1)c1cc2[C@H](Cc3ccccc3)[C@@H](COc2cc1F)NC
BDBM294262 CCCS(=O)(=O)NC1CN(C1)c1cc2[C@@H](Cc3ccccc3)[C@@H](COc2cc1F)NC
BDBM294263 CN[C@@H]1COc2cc(F)c(cc2[C@@H]1Cc1ccccc1)N1CC(C1)NS(=O)(=O)c1cnn(C)c1
BDBM294264 CN[C@@H]1COc2cc(F)c(cc2[C@H]1Cc1ccccc1)N1CC(C1)NS(=O)(=O)c1cnn(C)c1
BDBM294244 Cn1cnc(c1)S(=O)(=O)NC1CN(C1)c1ccc2OCC(C(Cc3ccccc3)c2c1)N1CCC1
BDBM294245 CCS(=O)(=O)NC1CN(C1)c1ccc2OC[C@H]([C@@H](Cc3ccccc3)c2c1)N1CCC1
BDBM294246 CCCS(=O)(=O)NC1CN(C1)c1ccc2OCC(C(Cc3ccccc3)c2c1)N1CCC1
BDBM294247 O=S(=O)(CC1CC1)NC1CN(C1)c1ccc2OCC(C(Cc3ccccc3)c2c1)N1CCC1
BDBM294248 Cn1cc(cn1)S(=O)(=O)NC1CN(C1)c1ccc2OCC(C(Cc3ccccc3)c2c1)N1CCC1
BDBM294249 Cn1cc(nn1)S(=O)(=O)NC1CN(C1)c1ccc2OCC(C(Cc3ccccc3)c2c1)N1CCC1
BDBM294250 CCn1cc(nn1)S(=O)(=O)NC1CN(C1)c1cc2[C@H](Cc3ccccc3)[C@@H](COc2cc1F)N1CCC1
BDBM294265 CN[C@@H]1COc2cc(F)c(cc2[C@@H]1Cc1ccccc1)N1CC(C1)NS(=O)(=O)c1cn(C)nn1
BDBM294266 CN[C@@H]1COc2cc(F)c(cc2[C@H]1Cc1ccccc1)N1CC(C1)NS(=O)(=O)c1cn(C)nn1
BDBM294267 CN[C@@H]1COc2cc(F)c(cc2[C@@H]1Cc1ccccc1)N1CC(C1)NS(=O)(=O)CC1CC1
BDBM294268 CN[C@@H]1COc2cc(F)c(cc2[C@H]1Cc1ccccc1)N1CC(C1)NS(=O)(=O)CC1CC1
BDBM294269 CCCS(=O)(=O)NC1CN(C1)c1ccc2OC[C@@H](N)[C@@H](Cc3ccccc3)c2c1
BDBM294270 N[C@@H]1COc2ccc(cc2[C@@H]1Cc1ccccc1)N1CC(C1)NS(=O)(=O)CC1CC1
BDBM294274 CN[C@@H]1COc2ccc(cc2[C@@H]1Cc1ccccc1)N1CC(C1)NS(=O)(=O)CC1CC1
BDBM294275 Fc1cncc(c1)S(=O)(=O)NC1CN(C1)c1cc2[C@H](Cc3ccccc3)[C@@H](COc2cc1F)[NH+]1CCC1
BDBM294278 CCCNC1COc2ccc(cc2C1Cc1ccccc1)N1CC(C1)NS(=O)(=O)CCC
BDBM294279 CCCS(=O)(=O)NC1CN(C1)c1ccc2OCC(C(Cc3ccccc3)c2c1)N(CC)CC
BDBM294280 CCCS(=O)(=O)NC1CN(C1)c1ccc2OCC(NCC3CC3)C(Cc3ccccc3)c2c1
BDBM294281 CCCS(=O)(=O)NC1CN(C1)c1ccc2OC[C@@H](NC3CCC3)[C@@H](Cc3ccccc3)c2c1
BDBM294227 Cn1cnc(c1)S(=O)(=O)NC1CN(C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1
BDBM294228 Cn1cnc(c1)S(=O)(=O)NC1CN(C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1 |r|
BDBM294229 CS(=O)(=O)NC1CN(C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1
BDBM294230 CCS(=O)(=O)NC1CN(C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1
BDBM294231 CCCS(=O)(=O)NC1CN(C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1
BDBM294232 FC1(F)Oc2ccc(cc2O1)S(=O)(=O)NC1CN(C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1 |r|
BDBM294233 Cn1cnc(c1)S(=O)(=O)NC1(C)CN(C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1
BDBM294234 CCS(=O)(=O)NC1(C)CN(C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1 |r|
BDBM294235 Cn1cnc(c1)S(=O)(=O)N[C@@H]1CCN(C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1
BDBM294236 Cn1cnc(c1)S(=O)(=O)N[C@H]1CCN(C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1 |r|
BDBM294237 Cn1cnc(c1)S(=O)(=O)NC1CCN(CC1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1
BDBM294238 Cn1cnc(c1)S(=O)(=O)N[C@H]1C[C@@H](C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1 |r,wU:12.15,20.35,21.23,wD:10.10,(-4.24,5.86,;-5.01,4.53,;-6.55,4.53,;-7.03,3.06,;-5.78,2.16,;-4.54,3.06,;-5.78,.62,;-4.24,.62,;-7.32,.62,;-5.78,-.92,;-4.45,-1.69,;-4.05,-3.18,;-2.56,-2.78,;-2.96,-1.29,;-1.23,-3.55,;-1.23,-5.09,;.1,-5.86,;1.44,-5.09,;2.77,-5.86,;4.1,-5.09,;4.1,-3.55,;2.77,-2.78,;2.77,-1.24,;1.44,-.47,;.1,-1.24,;-1.23,-.47,;-1.23,1.07,;.1,1.84,;1.44,1.07,;1.44,-3.55,;.1,-2.78,;5.44,-2.78,;6.93,-3.18,;7.32,-1.69,;5.84,-1.29,)|
BDBM294239 Cn1cnc(c1)S(=O)(=O)N[C@H]1C[C@H](C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1 |r,wU:21.23,20.35,12.15,10.10,(-4.24,5.86,;-5.01,4.53,;-6.55,4.53,;-7.03,3.06,;-5.78,2.16,;-4.54,3.06,;-5.78,.62,;-7.32,.62,;-4.24,.62,;-5.78,-.92,;-4.45,-1.69,;-2.96,-1.29,;-2.56,-2.78,;-4.05,-3.18,;-1.23,-3.55,;-1.23,-5.09,;.1,-5.86,;1.44,-5.09,;2.77,-5.86,;4.1,-5.09,;4.1,-3.55,;2.77,-2.78,;2.77,-1.24,;1.44,-.47,;.1,-1.24,;-1.23,-.47,;-1.23,1.07,;.1,1.84,;1.44,1.07,;1.44,-3.55,;.1,-2.78,;5.44,-2.78,;6.93,-3.18,;7.32,-1.69,;5.84,-1.29,)|
BDBM294240 CCCS(=O)(=O)N[C@H]1CCN(C1=O)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CCC1 |r|
BDBM294241 Cn1cnc(c1)S(=O)(=O)NC1CN(C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CC2CC2C1 |r|
BDBM294242 Cn1cc(nn1)S(=O)(=O)NC1CN(C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CC2CC2C1 |r|
BDBM294243 CCCS(=O)(=O)NC1CN(C1)c1ccc2CC[C@@H]([C@H](Cc3ccccc3)c2c1)N1CC2CC2C1