BindingDB logo
myBDB logout

2 SMILES Strings for Alpha-1B adrenergic receptor

Compound NameSMILES String
BDBM186927 C(CN1CCO[C@H](COc2ccccc2)C1)N1CCc2ccccc12 |r|
BDBM186935 Clc1cccc(OC[C@@H]2CN(CCN3CCc4ccccc34)CCO2)c1 |r|