BindingDB logo
myBDB logout

2 SMILES Strings for Alpha-L-fucosidase 2

Compound NameSMILES String
BDBM50072588 CC1NC(CO)[C@@H](O)[C@@H](O)[C@@H]1O
BDBM50065258 C[C@@H]1NC[C@@H](O)[C@H](O)[C@@H]1O