BindingDB logo
myBDB logout

2 SMILES Strings for Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase III

Compound NameSMILES String
BDBM50366830 Nc1ccn(C2O[C@H](COP([O-])(=O)N[C@H](c3ccccc3)P([O-])([O-])=O)[C@@H](O)[C@H]2O)c(=O)n1 |r|
BDBM50366831 Nc1ccn(C2O[C@H](COP([O-])(=O)N[C@@H](c3ccccc3)P([O-])([O-])=O)[C@@H](O)[C@H]2O)c(=O)n1 |r|