BindingDB logo
myBDB logout

8 SMILES Strings for Alpha-galactosidase

Compound NameSMILES String
BDBM50186732 C[C@H]1NC[C@H](O)[C@@H](O)C1(F)F
BDBM50186733 C[C@@H]1NC[C@@H](O)[C@H](O)C1(F)F
BDBM50186734 OC[C@H]1NC[C@H](O)[C@@H](O)C1(F)F
BDBM50186735 OC[C@H]1NC[C@@H](O)[C@@H](O)C1(F)F
BDBM50186736 OC[C@@H]1NC[C@@H](O)[C@@H](O)C1(F)F
BDBM50185228 CC[C@@H]1C[C@H](O)[C@@H](O)[C@@H](CO)N1
BDBM50185229 CCCCCCC[C@@H]1C[C@@H](O)[C@@H](O)[C@@H](CO)N1
BDBM50185230 CC[C@@H]1C[C@@H](O)[C@@H](O)[C@@H](CO)N1