BindingDB logo
myBDB logout

12 SMILES Strings for Alpha-galactosidase A

Compound NameSMILES String
BDBM50082234 OCC1NC(CO)[C@H](O)[C@@H](O)[C@@H]1O
BDBM50241865 OC[C@H]1N[C@H](CO)[C@H](O)[C@@H]1O |r|
BDBM50099009 NC[C@H]1N[C@H](CO)[C@H](O)[C@@H]1O
BDBM50350758 OC[C@H]1CNC[C@@H](O)[C@H]1O |r|
BDBM50403720 OC[C@H]1N[C@H](CO)[C@H](O)[C@H](O)[C@@H]1O
BDBM50150471 OCC[C@H]1NC[C@@H](O)[C@@H](O)[C@H]1CO |r|
BDBM50150472 NCCCC[C@H]1NC[C@@H](O)[C@@H](O)[C@H]1CO |r|
BDBM50150470 CN(C)c1cccc2c(cccc12)S(=O)(=O)NCCCC[C@H]1NC[C@@H](O)[C@@H](O)[C@H]1CO |r|
BDBM50204609 NC[C@H]1N[C@@H](CO)[C@H](O)[C@@H]1O |r|
BDBM50204611 OC[C@H]1NC[C@@H](O)[C@H]1O |r|
BDBM50204613 CC(=O)NC[C@H]1N[C@H](CO)[C@H](O)[C@@H]1O |r|
BDBM50204610 NC[C@@H]1N[C@H](CO)[C@H](O)[C@@H]1O |r|