BindingDB logo
myBDB logout

33 SMILES Strings for Alpha-glucosidase

Compound NameSMILES String
BDBM18351 OC[C@H]1NC[C@H](O)[C@@H](O)[C@@H]1O
BDBM18355 CCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO
BDBM50037814 OCC1NC(CO)C(O)C1O
BDBM50156353 CCCCCCC1NC(CO)C(O)C(O)C1O
BDBM50156354 CCCCCCN1CC(O)C(O)C(O)C1CO
BDBM50156355 CCCCC1NC(CO)C(O)C(O)C1O
BDBM50156356 CCCCCCCCC1NC(CO)C(O)C(O)C1O
BDBM50156357 CCCCCCCCCN1CC(O)C(O)C(O)C1CO
BDBM50156358 CCCC1NC(CO)C(O)C(O)C1O
BDBM50156359 CCCCCCCCN1CC(O)C(O)C(O)C1CO
BDBM50156360 CCCCCCCCCC1NC(CO)C(O)C(O)C1O
BDBM50156361 CCCN1CC(O)C(O)C(O)C1CO
BDBM50161653 OCC1OC(CNC(=O)CO)C(O)C(O)C1O
BDBM50163445 OC[C@@H]1NC[C@H](O)[C@@H](O)[C@H]1O
BDBM50163447 OC[C@@H]1NC[C@@H](O)[C@H](O)[C@H]1O
BDBM50240725 OC[C@H]1NCC[C@@H](O)[C@@H]1O |r|
BDBM50231670 OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCCCCCCOc1cccc(c1)-c1c[nH]nn1 |r|
BDBM50231671 OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCCCCOc1cccc(c1)-c1c[nH]nn1 |r|
BDBM50231672 OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCCOc1cccc(c1)-c1c[nH]nn1 |r|
BDBM50283598 NC1C(O)C(O)C(O)C1(O)CO
BDBM50283599 OCC1(O)C(O)C(O)C2(CO)OCC(Nc3ccccc3)=NC12 |c:21|
BDBM50283600 NC1C(O)C(O)C(O)C1O
BDBM50283601 OC1C(O)C2OC(Nc3ccccc3)=NC2C1O |c:14|
BDBM50283602 OCC12OC(Nc3ccccc3)=NC1C(O)C(O)C2O |c:12|
BDBM50283603 OCC1C(O)C(O)C2OC(Nc3ccccc3)=NC12 |c:17|
BDBM50283604 OCC1(O)C(O)C(O)C2N=C(Nc3ccccc3)OC12 |t:9|
BDBM50339929 NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CCC(=O)Nc1ccc(O)cc1 |r|
BDBM50339930 NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CCC(=O)Nc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |r|
BDBM50333465 C[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)O[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1N[C@H]1C=C(CO)[C@@H](O)[C@H](O)[C@H]1O |r,t:37|
BDBM50407255 CC[C@H]1NC[C@@H](O)[C@@H]1O |r|
BDBM50403869 CC[C@H]1NC[C@H](O)[C@@H]1O |r|
BDBM50437444 OC[C@H](O)[C@@H]1NC[C@@H]1O |r|
BDBM50437445 O[C@H]1CN2CCC[C@H](O)[C@@H]12 |r|