BindingDB logo
myBDB logout

10 SMILES Strings for Alpha-glucosidase MAL62

Compound NameSMILES String
BDBM18351 OC[C@H]1NC[C@H](O)[C@@H](O)[C@@H]1O
BDBM50031481 OC[C@H]1N[C@H](CO)[C@@H](O)[C@@H]1O |r|
BDBM50234562 OCCN1C[C@@H](O)[C@H](O)[C@H]1CO |r|
BDBM50242270 OCCN1[C@H](CO)[C@@H](O)[C@H](O)[C@H]1CO |r|
BDBM50341204 CCC\C=C1\OC(=O)c2ccccc12
BDBM50333465 C[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)O[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1N[C@H]1C=C(CO)[C@@H](O)[C@H](O)[C@H]1O |r,t:37|
BDBM50430739 C[C@@H]1CC[C@H]2C(C)(C)[C@H]3C[C@@]12CC[C@@]3(C)O
BDBM50430740 C[C@@H]1CC[C@H]2C(C)(C)[C@@H]3C[C@@]12CC[C@@]3(C)OC(C)=O |r|
BDBM50430738 CC(=O)O[C@]1(C)C[C@H](O)[C@@]23C[C@H]1C(C)(C)[C@@H]2CC[C@]3(C)O |r|
BDBM50016703 OC[C@H]1NC[C@@H](O)[C@@H]1O |r|