BindingDB logo
myBDB logout

34 SMILES Strings for Alpha-ketoglutarate-dependent dioxygenase FTO

Compound NameSMILES String
BDBM14672 OC(=O)CC(O)(CC(O)=O)C(O)=O
BDBM17657 N[C@@H](CCC(O)=O)C(O)=O
BDBM19473 CC(=O)C(O)=O
BDBM26431 N[C@H](CCC(O)=O)C(O)=O
BDBM26106 OC(=O)CNC(=O)C(O)=O
BDBM26113 OC(=O)c1ccnc(c1)C(O)=O
BDBM26122 OC(=O)\C=C\C(O)=O
BDBM92495 OC(CC(O)=O)C(O)=O
BDBM50036222 OC(=O)C\C(=C\C(O)=O)C(O)=O
BDBM50193145 OC(=O)CNC(=O)c1nc(Cl)c2ccccc2c1O
BDBM50277935 C[C@H](NC(=O)c1nc(Cl)c2ccccc2c1O)C(O)=O |r|
BDBM50277936 C[C@@H](NC(=O)c1nc(Cl)c2ccccc2c1O)C(O)=O |r|
BDBM50303763 CC(C)[C@@H](NC(=O)c1nc(Cl)c2ccccc2c1O)C(O)=O |r|
BDBM50303764 CC(C)[C@H](NC(=O)c1nc(Cl)c2ccccc2c1O)C(O)=O |r|
BDBM50328019 OC(=O)CNC(=O)c1ncccc1O
BDBM50344962 O[C@@H](CCC(O)=O)C(O)=O |r|
BDBM50361471 O[C@H](CCC(O)=O)C(O)=O |r|
BDBM50371704 Nc1c2C(=O)c3ccccc3C(=O)c2c(Br)cc1S([O-])(=O)=O
BDBM50396018 OC(=O)c1ccc(O)c2ncccc12
BDBM50431012 CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12)[C@H](O)C(=O)NCCC(=O)NCCSC(=O)CCC(O)=O |r|
BDBM50431013 O[C@@H]([C@@H](CC(O)=O)C(O)=O)C(O)=O |r|
BDBM50431014 OC(O)[C@@H](CC(O)=O)[C@@H](O)C(O)=O |r|
BDBM50431015 Cc1nc(C(=O)NCC(O)=O)c(O)c2ccc(Oc3ccccc3)cc12
BDBM50431016 OC(=O)[C@H](Cc1ccccc1)NC(=O)c1nc(Cl)c2ccccc2c1O |r|
BDBM50431017 OC(=O)[C@@H](Cc1ccccc1)NC(=O)c1nc(Cl)c2ccccc2c1O |r|
BDBM50431018 OC(=O)CNC(=O)c1ncc(cc1O)-c1ccc2ccccc2c1
BDBM50431019 OC(=O)CNC(=O)c1ncc(cc1O)-c1ccc2cc(O)ccc2c1
BDBM50431020 OC(=O)[C@H](CSCc1ccc2ccccc2c1)NC(=O)c1ncccc1O |r|
BDBM50431021 OC(=O)C=CC(=O)NNC(=O)c1ccc(cn1)-c1ccccc1Oc1ccccc1 |w:4.4|
BDBM50431022 CNS(=O)(=O)c1ccc(O)c2ncccc12
BDBM50431023 NS(=O)(=O)c1ccc(O)c2ncccc12
BDBM50431024 OC(=O)c1ccc2C(=O)c3cccc(O)c3C(=O)c2c1O
BDBM50420196 C[C@@H](O)C(O)=O |r|
BDBM50117830 Oc1cc(O)c(NC(=O)C2(CCC2)c2ccccc2)cc1Cl