BindingDB logo
myBDB logout

49 SMILES Strings for Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3

Compound NameSMILES String
BDBM58113 Cc1[nH]n(-c2nc3ccccc3[nH]2)c(=O)c1Cc1ccccc1
BDBM75610 O=c1cc([nH]n1-c1nc2ccccc2[nH]1)-c1ccccc1
BDBM50361127 Cc1[nH]n(-c2ccccn2)c(=O)c1C(=O)Nc1ccccc1
BDBM50447917 Cc1[nH]n(-c2nc3c(C)cccc3[nH]2)c(=O)c1C
BDBM50447918 Cc1[nH]n(-c2ccccn2)c(=O)c1C
BDBM50447911 Cc1[nH]n(-c2nc3ccc(C)c(C)c3[nH]2)c(=O)c1Cc1ccccc1
BDBM50447912 Cc1[nH]n(-c2nc3ccccc3[nH]2)c(=O)c1Cc1ccc(Cl)cc1Cl
BDBM50447913 Cc1[nH]n(-c2nc3ccccc3[nH]2)c(=O)c1Cc1ccc(Cl)cc1
BDBM50447914 Cc1[nH]n(-c2nc3ccccc3[nH]2)c(=O)c1Cc1ccccc1Cl
BDBM50447915 O=c1c(Cc2ccccc2)c([nH]n1-c1nc2ccccc2[nH]1)-c1ccccc1
BDBM50447916 Cc1c([nH]n(-c2nc3ccccc3[nH]2)c1=O)-c1ccccc1
BDBM50447919 Cc1[nH]n(-c2ncccn2)c(=O)c1C
BDBM50447920 Cc1[nH]n(-c2nc3ccccc3n2C)c(=O)c1C
BDBM50447921 Cc1[nH]n(-c2nc3ccccc3o2)c(=O)c1C
BDBM50447922 Cc1[nH]n(-c2nc3ccccc3s2)c(=O)c1C
BDBM50447923 Cc1[nH]n(-c2ccccc2)c(=O)c1C
BDBM50447924 Cc1[nH]n(-c2nc3ccccc3[nH]2)c(=O)c1CC(O)=O
BDBM50447926 Cc1[nH]n(-c2nc3c(C)cccc3[nH]2)c(=O)c1Cc1ccccc1
BDBM50447927 Cc1ccc2nc([nH]c2c1)-n1[nH]c(c(-c2ccccc2)c1=O)-c1ccccc1
BDBM50447928 Cc1[nH]n(-c2nc3ccc(C)cc3[nH]2)c(=O)c1Cc1ccc(cc1)-c1ccccc1
BDBM50447929 Cc1[nH]n(-c2nc3ccc(Cl)cc3[nH]2)c(=O)c1Cc1ccccc1
BDBM50447930 COC(=O)Cc1c(C)[nH]n(-c2nc3ccccc3[nH]2)c1=O
BDBM50447931 Cc1[nH]n(-c2nc3ccccc3[nH]2)c(=O)c1Cc1ccc(cc1)C(C)(C)C
BDBM50447932 Cc1[nH]n(-c2nc3ccccc3[nH]2)c(=O)c1C
BDBM50447933 Cc1[nH]n(-c2nc3ccc(C)cc3[nH]2)c(=O)c1Cc1ccc(cc1)C(C)(C)C
BDBM50447934 Cc1cc(=O)n([nH]1)-c1nc2ccccc2[nH]1
BDBM50447935 Cc1c([nH]n(-c2nc3ccc(C)cc3[nH]2)c1=O)-c1ccccc1
BDBM50447936 Cc1[nH]n(-c2nc3ccccc3[nH]2)c(=O)c1Cc1ccc(Cl)c(Cl)c1
BDBM50447937 Cc1[nH]n(-c2nc3ccc(C)cc3[nH]2)c(=O)c1C
BDBM50447938 Cc1[nH]n(-c2nc3cc(ccc3[nH]2)-c2ccc(C)cc2)c(=O)c1Cc1ccccc1
BDBM50447939 Clc1ccc2nc([nH]c2c1)-n1[nH]c(c(-c2ccccc2)c1=O)-c1ccccc1
BDBM50447940 Cc1[nH]n(-c2nc3cc(ccc3[nH]2)-c2ccc(Cl)cc2)c(=O)c1Cc1ccccc1
BDBM50447941 Cc1[nH]n(-c2nc3ccc(C)cc3[nH]2)c(=O)c1Cc1ccccc1Cl
BDBM50447942 Cc1[nH]n(-c2nc3cc(ccc3[nH]2)-c2ccccc2)c(=O)c1Cc1ccccc1
BDBM50447943 Cc1[nH]n(-c2nc3ccc(C)cc3[nH]2)c(=O)c1Cc1ccc(F)cc1
BDBM50447944 Cc1[nH]n(-c2nc3ccc(C)cc3[nH]2)c(=O)c1Cc1ccc(Cl)cc1
BDBM50447945 Cc1[nH]n(-c2nc3ccccc3[nH]2)c(=O)c1Cc1ccc2ccccc2c1
BDBM50447946 Cc1[nH]n(-c2nc3ccc(C)cc3[nH]2)c(=O)c1Cc1ccc(Cl)c(Cl)c1
BDBM50447947 Cc1[nH]n(-c2nc3ccccc3[nH]2)c(=O)c1Cc1ccc(cc1)-c1ccccc1
BDBM50447948 COc1ccc(Cc2c(C)[nH]n(-c3nc4ccc(C)cc4[nH]3)c2=O)cc1
BDBM50447949 Cc1[nH]n(-c2nc3ccc(C)cc3[nH]2)c(=O)c1Cc1ccccc1
BDBM50447950 Cc1[nH]n(-c2nc3ccc(cc3[nH]2)C(C)(C)C)c(=O)c1Cc1ccccc1
BDBM50447951 COc1ccc(Cc2c(C)[nH]n(-c3nc4ccccc4[nH]3)c2=O)cc1
BDBM50447952 Cc1[nH]n(-c2nc3ccc(cc3[nH]2)C(F)(F)F)c(=O)c1Cc1ccccc1
BDBM50447953 Cc1[nH]n(-c2nc3ccccc3[nH]2)c(=O)c1Cc1ccc(F)cc1
BDBM50447954 Cc1[nH]n(-c2nc3ccc(C)cc3[nH]2)c(=O)c1Cc1ccc(cc1)C(F)(F)F
BDBM50447955 Cc1[nH]n(-c2nc3ccccc3[nH]2)c(=O)c1Cc1ccc(cc1)C(F)(F)F
BDBM50447956 Cc1[nH]n(-c2nc3ccccc3[nH]2)c(=O)c1Cc1cccc(Cl)c1
BDBM50447957 Cc1[nH]n(-c2nc3ccc(Br)cc3[nH]2)c(=O)c1Cc1ccccc1