BindingDB logo
myBDB logout

2 SMILES Strings for Amiloride-sensitive cation channel 2, neuronal

Compound NameSMILES String
BDBM50348098 NCc1sc2cc(ccc2c1Cl)C#Cc1ccc2CCNCc2c1
BDBM50096642 CCN(CC)CCN(Cc1ccc(Cl)cc1)c1ccc2cc(C(N)=N)c(=O)oc2c1