BindingDB logo
myBDB logout

6 SMILES Strings for Amiloride-sensitive sodium channel subunit alpha

Compound NameSMILES String
BDBM50112167 Cl.[Cl-].Nc1nc(N)c(nc1Cl)C(=O)N[C@H]1CCC[N+](CCCc2ccc(OCC(=O)NCCc3ccccn3)cc2)(CCCc2ccc(OCC(=O)NCCc3ccccn3)cc2)C1 |r|
BDBM50112169 [Cl-].COc1ccc(CCC[N+]2(CCCc3ccc(cc3)C(=O)NCCCN(C)C)CCCC(C2)NC(=O)c2nc(Cl)c(N)nc2N)cc1
BDBM50112170 [O-]C(=O)C(F)(F)F.COc1ccc(CCC[N+]2(CCCc3ccccc3)CCCC(C2)NC(=O)c2nc(Cl)c(N)nc2N)cc1
BDBM50112171 Cl.[Cl-].Nc1nc(N)c(nc1Cl)C(=O)N[C@H]1CCC[N+](CCCc2ccc(OCC(=O)NCCn3ccnc3)cc2)(CCCc2ccc(OCC(=O)NCCn3ccnc3)cc2)C1 |r|
BDBM50112168 [Cl-].COc1ccc(CCC[N@@+]2(C)CCC[C@@H](C2)NC(=O)c2nc(Cl)c(N)nc2N)cc1 |r|
BDBM50112172 [Cl-].Nc1nc(N)c(nc1Cl)C(=O)N[C@H]1CCC[N+](CCCc2ccc(OCC(=O)NCCCO)cc2)(CCCc2ccc(OCC(=O)NCCCO)cc2)C1 |r|