BindingDB logo
myBDB logout

18 SMILES Strings for Amine oxidase, copper containing

Compound NameSMILES String
BDBM50161135 CNc1cnccc1CN
BDBM50161137 CNc1ccccc1CN
BDBM50161139 NCc1ccncc1NC1CCCC1
BDBM50161140 NCc1ccncc1NCC1CCCCC1
BDBM50161141 NCc1ccncc1N(C1CCCC1)C1CCCC1
BDBM50161142 CCNc1ccccc1CN
BDBM50161143 CCOc1cncc(OCC)c1CN
BDBM50161146 CNc1cncc(N(C)C)c1CN
BDBM50161147 NCc1ccncc1NC1CC1
BDBM50161148 NCc1ccncc1NC1CCCCC1
BDBM50161152 CC(C)Nc1cnccc1CN
BDBM50161132 CCNc1cnccc1CN
BDBM50161133 NCc1ccncc1NC1CCCCCC1
BDBM50161134 CCNc1cncc(N(C)CC)c1CN
BDBM50246766 NC\C(CCc1ccc(F)cc1)=C\F
BDBM50384083 NC\C=C(\F)COc1ccc(cc1)C(=O)NC1CCCC1
BDBM50384084 NC\C=C(\F)COc1ccc(cc1)C(=O)NC1CCCCC1
BDBM50384088 C[C@H](NC(=O)c1ccc(OC\C(F)=C/CN)cc1)c1ccccc1 |r|