BindingDB logo
myBDB logout

3 SMILES Strings for Amine oxidase (AGAO)

Compound NameSMILES String
BDBM185656 NCC#CCC(N)C(=O)NCCc1ccccc1
BDBM185657 CCOC(=O)CNC(=O)CNC(=O)C(N)CC#CCN
BDBM185658 CCCNC(=O)C(N)CC#CCN