BindingDB logo
myBDB logout

20 SMILES Strings for Amino acid transporter

Compound NameSMILES String
BDBM50140133 COc1ccc(Oc2ccccc2CN(CC[C@H](N)C(O)=O)Cc2ccccc2Oc2ccc(OC)cc2)cc1 |r|
BDBM50140080 N[C@@H](CCN(Cc1ccccc1OCc1cccnc1)Cc1ccccc1OCc1cccnc1)C(O)=O |r|
BDBM50140079 N[C@@H](CCN(Cc1ccccc1OCc1cccc(c1)C(F)(F)F)Cc1ccccc1OCc1cccc(c1)C(F)(F)F)C(O)=O |r|
BDBM50140081 N[C@@H](CCN(Cc1ccccc1OCc1ccccn1)Cc1ccccc1OCc1ccccn1)C(O)=O |r|
BDBM50140082 N[C@@H](CCN(Cc1ccccc1OCc1ccc(F)cc1)Cc1ccccc1OCc1ccc(F)cc1)C(O)=O |r|
BDBM50140083 N[C@@H](CCN(Cc1ccccc1OCc1ccccc1F)Cc1ccccc1OCc1ccccc1F)C(O)=O |r|
BDBM50140084 Cc1ccc(COc2ccccc2CN(CC[C@H](N)C(O)=O)Cc2ccccc2OCc2ccc(C)cc2)cc1 |r|
BDBM50140122 Cc1cccc(COc2ccccc2CN(CC[C@H](N)C(O)=O)Cc2ccccc2OCc2cccc(C)c2)c1 |r|
BDBM50140123 Cc1ccccc1COc1ccccc1CN(CC[C@H](N)C(O)=O)Cc1ccccc1OCc1ccccc1C |r|
BDBM50140124 N[C@@H](CCN(Cc1ccccc1OCc1ccc(Cl)cc1)Cc1ccccc1OCc1ccc(Cl)cc1)C(O)=O |r|
BDBM50140125 N[C@@H](CCN(Cc1ccccc1OCc1cccc(Cl)c1)Cc1ccccc1OCc1cccc(Cl)c1)C(O)=O |r|
BDBM50140126 N[C@@H](CCN(Cc1ccccc1OCc1ccccc1Cl)Cc1ccccc1OCc1ccccc1Cl)C(O)=O |r|
BDBM50140127 COc1cccc(COc2ccccc2CN(CC[C@H](N)C(O)=O)Cc2ccccc2OCc2cccc(OC)c2)c1 |r|
BDBM50140128 N[C@@H](CCN(Cc1ccccc1Oc1ccccn1)Cc1ccccc1Oc1ccccn1)C(O)=O |r|
BDBM50140129 N[C@@H](CCN(Cc1ccccc1Oc1ccc(F)cc1)Cc1ccccc1Oc1ccc(F)cc1)C(O)=O |r|
BDBM50140130 N[C@@H](CCN(Cc1ccccc1Oc1cccc(F)c1)Cc1ccccc1Oc1cccc(F)c1)C(O)=O |r|
BDBM50140131 N[C@@H](CCN(Cc1ccccc1Oc1ccccc1F)Cc1ccccc1Oc1ccccc1F)C(O)=O |r|
BDBM50140132 N[C@@H](CCN(Cc1ccccc1Oc1ccc(Cl)cc1)Cc1ccccc1Oc1ccc(Cl)cc1)C(O)=O |r|
BDBM50140134 COc1cccc(Oc2ccccc2CN(CC[C@H](N)C(O)=O)Cc2ccccc2Oc2cccc(OC)c2)c1 |r|
BDBM50088537 N[C@@H](CCC(=O)Nc1ccc(cc1)[N+]([O-])=O)C(O)=O