BindingDB logo
myBDB logout

37 SMILES Strings for Aminoacyl-tRNA synthetase

Compound NameSMILES String
BDBM19 NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O |r|
BDBM35453 OC(=O)c1cc(nc2ccccc12)-c1ccco1
BDBM43823 O=C(Nc1ccc2OCCOc2c1)c1cccc(c1)S(=O)(=O)N1CCCCC1
BDBM43824 CC(C)CC(=O)NC(N)=Nc1nc2ccccc2s1 |w:9.9|
BDBM43825 COC(=O)C(C=Nc1cccc(Cl)c1C)c1ncc(cc1Cl)C(F)(F)F |w:6.6|
BDBM43826 CCN(CC)S(=O)(=O)c1ccc2n(c(SC(C)C(N)=O)nc2c1)-c1ccc(OC)cc1
BDBM43827 OC(=O)\C=C\c1cn(Cc2ccccc2)nc1-c1ccccc1
BDBM50097094 OC(=O)c1cc(nc2ccccc12)-c1ccc(Br)cc1
BDBM50097097 OC(=O)c1cc(nc2ccccc12)-c1ccncc1
BDBM50097098 OC(=O)c1cc(nc2ccccc12)-c1ccc(Cl)s1
BDBM50097100 OC(=O)c1cc(nc2ccccc12)-c1ccccc1
BDBM50097082 OC(=O)c1cc(nc2ccc(I)cc12)-c1ccc(Br)cc1
BDBM50097083 OC(=O)c1cc(nc2ccccc12)-c1ccc(Cl)c(Cl)c1
BDBM50097084 Cc1cc(Cl)cc2nc(cc(C(O)=O)c12)-c1ccc(Br)cc1
BDBM50097085 OC(=O)c1cc(nc2ccc(cc12)S(O)(=O)=O)-c1ccc(Br)cc1
BDBM50097086 Cc1cc(Cl)cc2c(cc(nc12)-c1ccc(Br)cc1)C(=O)Oc1nnn[nH]1
BDBM50097087 OC(=O)\C=C\c1ccc2nc(cc(C(O)=O)c2c1)-c1ccc(Br)cc1
BDBM50097088 Cc1cc(C)c2nc(cc(C(O)=O)c2c1)-c1ccc(Br)cc1
BDBM50097090 OC(=O)c1cc(nc2ccc(Cl)cc12)-c1ccc(Br)cc1
BDBM50097091 OC(=O)c1cc(nc2cc(Cl)cc(Cl)c12)-c1ccc(Br)cc1
BDBM50097092 COC(=O)C(Cc1ccccc1)NC(=O)c1cc(nc2c(C)cc(Cl)cc12)-c1ccc(Br)cc1
BDBM50097093 Cc1c(Br)ccc2c(cc(nc12)-c1ccc(Br)cc1)C(O)=O
BDBM50097095 Cc1cc(Cl)cc2c(cc(nc12)-c1ccc(Br)cc1)C(=O)OCc1ccc(Cl)c(Cl)c1
BDBM50097096 Cc1cc(Cl)cc2c(cc(nc12)-c1ccc(Br)cc1)C(O)=O
BDBM50097099 Nc1ccc2nc(cc(C(O)=O)c2c1)-c1ccc(Br)cc1
BDBM50097101 OC(=O)c1cc(nc2ccccc12)-c1ccc2ccccc2c1
BDBM50097102 Cc1cc(Cl)cc2c(cc(nc12)-c1ccc(Br)cc1)C(=O)OCc1ccco1
BDBM50097103 OC(=O)c1cc(nc2ccc(cc12)-c1ccc(O)cc1)-c1ccc(Br)cc1
BDBM50097104 OC(=O)c1cc(nc2c(cc(Br)cc12)C(F)(F)F)-c1ccc(Br)cc1
BDBM50097105 OC(=O)c1cc(nc2ccc(Br)cc12)-c1ccc(Br)cc1
BDBM50097106 Cc1cc(Cl)c2nc(cc(C(O)=O)c2c1)-c1ccc(Br)cc1
BDBM50097107 Cc1c(F)ccc2c(cc(nc12)-c1ccc(Br)cc1)C(O)=O
BDBM50097108 Cc1cc(Cl)cc2c(cc(nc12)-c1ccc(Br)cc1)C(=O)OCc1ccc(cc1)-c1ccccc1
BDBM50097109 OCc1cc(Cl)cc2c(cc(nc12)-c1ccc(Br)cc1)C(O)=O
BDBM50097110 OC(=O)c1cc(nc2ccccc12)-c1ccc(cc1)C(F)(F)F
BDBM50097112 COc1ccc(cc1)-c1cc(C(O)=O)c2ccccc2n1
BDBM50097113 OC(=O)c1cc(nc2ccc(OC(F)(F)F)cc12)-c1ccc(Br)cc1